افتح القائمة الرئيسية

تغييرات

تم إضافة 1٬679 بايت ، ‏ قبل 7 سنوات
لا يوجد ملخص تحرير
 
{{chembox
| Watchedfields = changed
| verifiedrevid = 443422624
|ImageFile=Bilirubin_ZZ.png
|ImageSize=
|ImageFile1 = Bilirubin-from-xtal-1978-3D-balls.png
|OtherNames= Pheophytin
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4444055
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = RFM9X3LJ49
| InChIKey = BPYKTIZUTYGOLE-IFADSCNNBS
| SMILES1 = Cc1c(c([nH]c1/C=C\2/C(=C(C(=O)N2)C=C)C)Cc3c(c(c([nH]3)/C=C\4/C(=C(C(=O)N4)C)C=C)C)CCC(=O)O)CCC(=O)O
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 501680
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C33H36N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7-8,13-14,34-35H,1-2,9-12,15H2,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b26-13-,27-14-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BPYKTIZUTYGOLE-IFADSCNNSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=635-65-4
| PubChem = 5280352
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16990
| SMILES = O=C4/C(=C(/C=C)\C(=C\c1c(c(c(n1)Cc3c(c(c(/C=C2/C(=C(/C=C)C(=O)N2)C)n3)C)CCC(=O)O)CCC(=O)O)C)N4)C
| InChI = 1/C33H36N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7-8,13-14,34-35H,1-2,9-12,15H2,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b26-13-,27-14-
}}
|Section2={{Chembox Properties
| C = 33
| H = 36
| N = 4
| O = 6
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}}
[[ملف:Bilirubin2.svg|thumb|يسار|200px|البيليروبين]]
 
29٬107

تعديل