فيتامين بي5: الفرق بين النسختين

تم إضافة 2٬754 بايت ، ‏ قبل 8 سنوات
لا يوجد ملخص تحرير
ط (r2.7.3) (روبوت تعديل: hi:पोषक ख५)
{{chembox
| Watchedfields = changed
| verifiedrevid = 464185145
| ImageFile = Pantothenic acid.svg
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageName = Skeletal formula of pantothenic acid with some implicit hydrogens shown, and an explicit hydrogen added
| PIN = 3-[(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid{{citation needed|date=July 2012}}
| SystematicName = 3-(2,4-Dihydroxy-3,3-dimethylbutanamido)propanoic acid<ref>{{cite web|title=pantothenic acid (CHEBI:7916)|url=https://www.ebi.ac.uk/chebi/searchId.do?chebiId=7916|work=Chemical Entities of Biological Interest|publisher=European Bioinformatics Institute|accessdate=3 July 2012|location=UK|date=16 November 2011|at=Main}}</ref>
| Section1 = {{chembox Identifiers
| CASNo = 599-54-2
| CASNo_Ref = {{cascite|correct|??}}
| CASNo1 = 79-83-4
| CASNo1_Ref = {{cascite|correct|CAS}}
| CASNo1_Comment = <small>''R''</small>
| PubChem = 988
| PubChem_Ref = {{pubchemcite|correct|pubchem}}
| PubChem1 = 6613
| PubChem1_Ref = {{pubchemcite|correct|pubchem}}
| PubChem1_Comment = <small>''R''</small>
| PubChem2 = 5748353
| PubChem2_Ref = {{pubchemcite|correct|pubchem}}
| PubChem2_Comment = <small>''S''</small>
| ChemSpiderID = 963
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1 = 6361
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1_Comment = <small>''R''</small>
| ChemSpiderID2 = 4677898
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID2_Comment = <small>''S''</small>
| UNII = 568ET80C3D
| UNII_Ref = {{fdacite|correct|FDA}}
| EINECS = 209-965-4
| DrugBank = DB01783
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| KEGG = D07413
| KEGG_Ref = {{keggcite|correct|kegg}}
| MeSHName = Pantothenic+Acid
| ChEBI = 7916
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1594
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| Beilstein = 1727062, 1727064 <small>''R''</small>
| 3DMet = B00193
| SMILES = CC(C)(CO)C(O)c(:[o]):[nH]CCc(:[o]):[oH]
| SMILES1 = CC(C)(CO)C(O)C(=O)NCCC(O)=O
| StdInChI = 1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GHOKWGTUZJEAQD-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
}}
| Section2 = {{chembox Properties
| C = 9
| H = 17
| N = 1
| O = 5
| Density = 1.266 g mL<sup>−1</sup>
| MeltingPtC = 183.83
| BoilingPtC = 551.5
| LogP = −0.856
| pKa = 4.299
| pKb = 9.698
}}
| Section3 = {{chembox Related
| Function = alkanoic acids
| OtherFunctn = {{unbulleted list|[[Arginine]]|[[Theanine]]|[[Hopantenic acid]]|[[4-(γ-Glutamylamino)butanoic acid]]}}
| OtherCpds = [[Panthenol]]
}}
}}
 
[[ملف:200px-Pantothenic-acid.png|تصغير|حمض بانتوثينيك]]حمض بانتوثينيك هو اسم '''فيتامين بي5''' المكون من اتحاد حمض بانتويك مع بيتا [[الانين]].
وهو موجود في معظم الأطعمة خاصةً في البقوليات والخضراوات والبيض واللحوم الحمراء وغذاء ملكات النحل.
33٬193

تعديل