افتح القائمة الرئيسية

تغييرات

تم إضافة 1٬370 بايت ، ‏ قبل 7 سنوات
لا يوجد ملخص تحرير
{{Chembox
{| class="toccolours" border="1" style="float: left; clear: left; margin: 0 0 1em 1em; border-collapse: collapse;"
| Verifiedfields = changed
! {{chembox header}}| '''{{PAGENAME}}'''
| Watchedfields = changed
|-
| verifiedrevid = 458451303
| align="center" colspan="2" bgcolor="#ffffff" | [[ملف:Riboflavin.png|{{PAGENAME}}]]
| ImageFile = Riboflavin.svg
|-
| ImageFile_Ref = {{chemboximage|correct|??}}
| الاسم
| ImageName = Kekulé, skeletal formula of a minor riboflavin (-10-[(2S,3S,4R)-2,3,4-trihydroxypentyl]) tautomer
| {{PAGENAME}}
| ImageFileL1 = Riboflavin-3d.png
|-
| ImageFileL1_Ref = {{chemboximage|correct|??}}
|أسماء أخرى
| ImageNameL1 = Spacefill model of a minor riboflavin (-10-[(2S,3S,4R)-2,3,4-trihydroxypentyl]) tautomer
|ريبوفلافين
| ImageFileR1 = Riboflavin powder.jpg
|-
| ImageNameR1 = Sample of microcrystaline riboflavin
| التركيب الكيميائي
| IUPACName = 7,8-Dimethyl-10-[(2''S'',3''S'',4''R'')-2,3,4,5-tetrahydroxypentyl]benzo[''g'']pteridine-2,4-dione<ref>{{PubChem|493570}}</ref>
| C<sub>17</sub>H<sub>20</sub>N<sub>4</sub>O<sub>6</sub>
| Section1 = {{Chembox Identifiers
|-
| CASNo = 83-88-5
| [[كتلة مولية|الكتلة المولية]]
| CASNo_Ref = {{cascite|correct|CAS}}
| 376.369 غ/[[مول]]
| PubChem = 493570
|-
| PubChem_Ref = {{Pubchemcite|correct|Pubchem}}
| [[درجة انصهار|درجة الانصهار]]
| ChemSpiderID = 431981
| 290 °س يتفكك
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
|-
| EINECS = 201-507-1
| {{chembox header}} | <small>[[ويكيبيديا:Chemical infobox|استعمال القالب]]</small>
| UNII_Ref = {{fdacite|correct|FDA}}
|-
| UNII = TLM2976OFR
|}
| DrugBank = DB00140
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| KEGG = D00050
| KEGG_Ref = {{keggcite|changed|kegg}}
| MeSHName = Riboflavin
| ChEBI = 17015
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 511565
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ATCCode_prefix = A11
| ATCCode_suffix = HA04
| Beilstein = 97825
| 3DMet = B01201
| SMILES = O=C2/N=C\1/N(c3cc(c(cc3/N=C/1C(=O)N2)C)C)C[C@H](O)[C@H](O)[C@H](O)CO
| StdInChI = InChI=1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = AUNGANRZJHBGPY-SCRDCRAPSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
|}}
| Section2 = {{Chembox Properties
| C=17|H=20|N=4|O=6
| ExactMass = 376.138284392 g mol<sup>-1</sup>
| Appearance = Orange crystals
| LogP = 0.095
| pKa = 9.888
| pKb = 4.109
}}
| Section3 = {{Chembox Hazards
| NFPA-H = 1
| NFPA-F = 1
| NFPA-R = 0
}}
}}
 
'''الرايبوفلافين''' أو '''فيتامين بي2'''{{إنج|Riboflavin}} وهو [[فيتامين]] قابل للذوبان في ال[[ماء]] من مجموعة فيتامينات بي
29٬107

تعديل