فيتامين بي5: الفرق بين النسختين

تم إضافة 662 بايت ، ‏ قبل 3 سنوات
استرجاع تعديلات JarBot (نقاش) حتى آخر نسخة بواسطة
ط (بوت:إضافة وصلة لمقالة يتيمة)
ط (استرجاع تعديلات JarBot (نقاش) حتى آخر نسخة بواسطة
{{معلومات كيمياء
{{يتيمة|تاريخ=فبراير 2017}}
| Watchedfields = changed
| verifiedrevid = 464185145
{{معلومات كوكب
| صورة = Pantothenic acid.svg
|العرض = <!--(يُفضل وضع العرض بوحدات نسبية)-->
| مرجع صورة = {{chemboximage|correct|??}}
|الاسم =
| اسم صورة = Skeletal formula of pantothenic acid with some implicit hydrogens shown, and an explicit hydrogen added
|الرمز = <!--([[ملف:...]])-->
| التسمية المفضلة = 3-[(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid{{بحاجة لمصدر|تاريخ=يوليو 2012}}
|خلفية =
| تسمية الاتحاد الدولي = 3-(2,4-Dihydroxy-3,3-dimethylbutanamido)propanoic acid<ref>{{مرجع ويب|العنوان=pantothenic acid (CHEBI:7916)|المسار=https://www.ebi.ac.uk/chebi/searchId.do?chebiId=7916|العمل=Chemical Entities of Biological Interest|الناشر=European Bioinformatics Institute|تاريخ الوصول=3 July 2012|المكان=UK|التاريخ=16 November 2011|at=Main}}</ref>
|الصورة =[[File:Damocloid-99XS35.png|275px|orbit of 1999 XS35]]
| قسم1 = {{معلومات كيمياء -معرفات
|التعليق = مدار {{Mp|1999 XS|35}} المشابة لمدار [[مذنب]]
| CASNo = 599-54-2
|مرجع_الاكتشاف = <ref name="MPEC1999-X19"/>
| CASNo_Ref = {{cascite|correct|??}}
|المكتشف = [[مرصد لويل للبحث عن الأجرام القريبة من الأرض]]
| CASNo1 = 79-83-4
|موقع_الاكتشاف =
| CASNo1_Ref = {{cascite|correct|CAS}}
|الاكتشاف =1999-12-02
| CASNo1_Comment = <small>''R''</small>
|وسيلة_الاكتشاف =
| PubChem = 988
|تسمية_الكوكب_الصغير = {{Mp|1999 XS|35}}
| PubChem_Ref = {{pubchemcite|correct|pubchem}}
|فئة_الكوكب_الصغير =
| PubChem1 = 6613
|أسماء_بديلة =
| PubChem1_Ref = {{pubchemcite|correct|pubchem}}
|مرجع_المدار =<ref name="jpldata"/>
| PubChem1_Comment = <small>''R''</small>
|الدهر = 13 يناير 2016
| PubChem2 = 5748353
|القبا =
| PubChem2_Ref = {{pubchemcite|correct|pubchem}}
|الأوج = {{حول|34.711|AU|Tm|abbr=on|lk=on}} <br>(وراء [[نبتون]])
| PubChem2_Comment = <small>''S''</small>
|الحضيض = {{حول|0.95932|AU|Gm|abbr=on}}
| ChemSpiderID = 963
|الكم =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
|البعد =
| ChemSpiderID1 = 6361
|نصف المحور الرئيسي = {{حول|17.835|AU|Tm|abbr=on}}
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
|الشذوذ المداري = 0.94621
| ChemSpiderID1_Comment = <small>''R''</small>
|فترة الدوران =
| ChemSpiderID2 = 4677898
|الفترة_الإقترانية =
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
|متوسط_السرعة_المدارية = <!--(متوسط السرعة المدارية)-->
| ChemSpiderID2_Comment = <small>''S''</small>
ّ|زاوية_وسط_الشذوذ = 77.641[[درجة (زاوية)|°]]
| UNII = 568ET80C3D
|الميل المداري = 19.414°
| UNII_Ref = {{fdacite|correct|FDA}}
|قطر_زاو = <!--(المسافة الزاوية)-->
| EINECS = 209-965-4
|زاوية_نقطة_الاعتدال =49.206°
| DrugBank = DB01783
|خط_طول_الكم = <!--(خط طول الكم)-->
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
|زمن_الكم = <!--(زمن الكم)-->
| KEGG = D07413
|زاوية_الحضيض =333.00°
| KEGG_Ref = {{keggcite|correct|kegg}}
|نصف-المطال =
| MeSHName = Pantothenic+Acid
|تابع_إلى =
| ChEBI = 7916
|الأقمار =
| ChEBI_Ref = {{ebicite|correct|EBI}}
|الأبعاد = 1–2 كم<ref name="jpldata"/><ref name="h">{{مرجع ويب
| ChEMBL = 1594
|العنوان=Absolute Magnitude (H)
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| Beilstein = 1727062, 1727064 <small>''R''</small>
| 3DMet = B00193
|مسار الأرشيف=https://web.archive.org/web/20091126011612/http://neo.jpl.nasa.gov/glossary/h.html
| SMILES = CC(C)(CO)C(O)c(:[o]):[nH]CCc(:[o]):[oH]
|تاريخ الأرشيف=26 نوفمبر 2009
|وصلة مكسورة=no}}</ref>
| StdInChI = 1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)
|التسطيح =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
|نصف_القطر_الإستوائي =
|نصف_القطر_القطبي =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
|متوسط_نصف_القطر =
|المحيط =
| قسم2 = {{معلومات كيمياء - خواص
|مساحة_السطح =
|الحجم C = 9
|الكتلة H = 17
|الكثافة N = 1
| O = 5
|جاذبية_السطح = <!--(جاذبية السطح عند خط الإستواء)-->
| Density = 1.266 g mL<sup>−1</sup>
|سرعة_الإفلات =
| MeltingPtC = 183.83
|اليوم_الفلكي =
| BoilingPtC = 551.5
|سرعة_الدوران = <!--(سرعة الدوران)-->
| LogP = −0.856
|الميل المحوري =
| pKa = 4.299
|المطلع_المستقيم_القطبي_الشمالي = <!--(المطلع المستقيم القطبي الشمالي)-->
| pKb = 9.698
|الميلان = <!--(الميلان القطبي)-->
|خط_العرض_الكسوفي_القطبي = <!--(خط العرض الكسوفي القطبي)-->
| قسم3 = {{معلومات كيمياء - متعلقة
|خط_الطول_الكسوفي_القطبي = <!--(خط الطول الكسوفي القطبي)-->
| تسمية أخرى = alkanoic acids
|البياض =
| أخرى ذات علاقة = {{unbulleted list|[[أرجنين]]|[[Theanine]]|[[Hopantenic acid]]|[[4-(γ-Glutamylamino)butanoic acid]]}}
|درجة_حرارة =
| مركبات ذات علاقة = [[Panthenol]]
|وحدة_الحرارة1 =
|الدرجة_الدنيا_1 =
|الدرجة_المتوسطة_1 =
|الدرجة_القصوى_1 =
|وحدة_الحرارة2 =
|الدرجة_الدنيا_2 =
|الدرجة_المتوسطة_2 =
|الدرجة_القصوى_2 =
|النمط_الطيفي =
|القدر = <!--(القدر الظاهري)-->
|القدر_المطلق = 17.2<ref name="jpldata"/>
|القطر_الزاوي =
|اللفظ =
|الصفات =
|{مرجع_الغلاف_الجوي = <ref name="ReferenceA"/>
|الضغط_السطحي =
|مقياس_الارتفاع =
|عناصر_الغلاف_الجوي =
'''{{Mp|1999 XS|35}}''' هو [[كويكب]] ومن [[أجرام قريبة من الأرض|الأجسام القريبة من الأرض]] اكتشف في عام [[1999]] <ref name=jpldata>{{مرجع ويب
|type=last observation: 2000-02-28; [[قوس المراقبة]]: 88 days; [[Uncertainty Parameter U|uncertainty]]: 4
|العنوان=JPL Small-Body Database Browser: (1999 XS35)
|الناشر=Jet Propulsion Laboratory
}}</ref> ولة مدار مشابة [[مذنب|للمذنب]] - [[نصف المحور الرئيسي]] 17.8 وحدة فلكية و[[انحراف مداري|الانحراف هو 0.94]]
[[مدار]] كويكب 1999 XS35 عندما يكون في الحضيض (أقرب نقطة من الشمس ) يكون على بعد 0.9 [[وحدة فلكية]] إلى الشمس، بينما في الأوج فأن مدارة يتجاوز مدار [[نبتون]] .<ref name=jpldata/>
{{Mp|1999 XS|35}} جاء إلى الحضيض في 21 أكتوبر 1999 ,<ref name="jpldata"/> ومر {{حول|0.0453|AU|km mi|abbr=on|lk=on}} من الأرض في 5 نوفمبر 1999 <ref name=jpl-close>{{مرجع ويب
|type=last observation: 2000-02-28; [[قوس المراقبة]]: 88 days; [[Uncertainty Parameter U|uncertainty]]: 4
|العنوان=JPL Close-Approach Data: (1999 XS35)
واكتشف بواسطة [[مرصد لويل للبحث عن الأجرام القريبة من الأرض]] في 2 كانون الأول 1999 وكان [[القدر الظاهري]] لة حوالي 16.9<ref name="MPEC1999-X19">{{مرجع ويب
|العنوان=MPEC 1999-X19 : 1999 XS35
|الناشر=IAU Minor Planet Center
[[ملف:200px-Pantothenic-acid.png|تصغير|حمض بانتوثينيك]]حمض بانتوثينيك هو اسم '''فيتامين بي5''' المكون من اتحاد حمض بانتويك مع بيتا [[الانين]].
== وصلات خارجية ==
وهو موجود في معظم الأطعمة خاصةً في البقوليات والخضراوات والبيض واللحوم الحمراء وغذاء ملكات النحل.
* [http://ssd.jpl.nasa.gov/sbdb.cgi?sstr=1999XS35;orb=1;view=Far Orbital simulation] from JPL (Java) / [http://ssd.jpl.nasa.gov/horizons.cgi?find_body=1&body_group=sb&sstr=1999XS35 Ephemeris]
* {{JPL small body}}
الحبوب الكاملة هي أيضاً مصدر جيد لهذا الفيتامين ولكن الطحن غالباً ما يزيل الكثير من حمض البانتوثنيك بما أنه موجود في الطبقات الخارجية من الحبوب الكاملة.
== أهميته الحيوية ==
يمتص [[حمض البانتوثينيك]] في الأمعاء ثم تتم فسفرته بواسطة [[ثلاثي فوسفات الأدينوسين]] (أدينوزين ثلاثي الفوسفات) إلى 4-فوسفوبانتوثينات.
والصورة النشطة من حمض [[البانتوثينيك]] هي كونزيم أcoenzyme A (CoA) والبروتين الحامل الأسيلAcyl Carrier Protein (ACP) وكوإنزيم (مساعد إنزيم) أ يعمل في أيض ونقل السلاسل الكربونية ولذلك فهو مطلوب لهدم [[كربوهيدرات|الكربوهيدرات]] و[[بروتين|البروتينات]] و[[لبيدات|اللبيدات]].
الفيتامين مطلوب أيضاً للنمو الصحي السليم للشعر وهو يستخدم في الطب الطبيعي كبديل لل[[كورتيزون]].
== الآثار الجانبية ==
نقص فيتامين بي5 نادر لأنه منتشر في أغلب أنواع الطعام كما هو مذكور سابقاً. وهذا النقص يسبب [[متلازمة القدم المحترقة]] التي لوحظت في أسرى الحرب وهي مصحوبة بنقص القدرة على إضافة مجموعة [[أسيتيل|الأسيتيل]].
وأعراض النقص هذه تشمل الحساسية ونقص هرمونات ال[[غدة الكظرية]] ومرض أديسون و[[روماتويد]] المفاصل.
وقد اظهرت دراسة في عام [[1997]] أن [[حب الشباب]] قد يكون مرتبطاً بنقص فيتامين بي5.
== التسمم ==
التسمم من الفيتامين ب5 غير محتمل. لا يوجد "المستوى الأعلى المسموح" لهذا الفيتامين. لا يوجد عوارض جانبيّة عند تناول كمية كبيرة من الفيتامين ب5 ولكن تناول كميات مثل 10غ يومياً قد يؤدي إلى الإسهال أو إلى اضطرابات معويّة.
== اقرأ أيضاً ==
[[فيتامين أ]]
[[فيتامين دي]]
[[فيتامين بي مركب]]
[[فيتامين بي1 (ثيامين)]]
[[فيتامين بي2 (رايبوفلافين)]]
[[فيتامين بي3 (ناياسين)]]
[[فيتامين بي6 (بيريدوكسين)]]
[[فيتامين بي7 (بيوتين)]]
[[حمض فوليك (بي 9)]]
[[فيتامين بي12 (كوبالامين)]]
[[فيتامين سي (حمض أسكوربيك)]]
[[فيتامين إي]]
[[فيتامين كي]]
== المراجع ==
* http://en.wikipedia.org/wiki/Vitamin_B5
{{أجرام النظام الشمسي الصغيرة}}
* Harper’s Biochemistry
{{شريط بوابات|المجموعة الشمسية|علم الفلك}}
* http://www.emedicine.com
* http://books.nap.edu/catalog.php?record_id=6015
{{شريط بوابات|كيمياء|طب}}
{{تصنيف كومنز|Pantothenic acid}}
{{ضبط استنادي}}
[[تصنيف:أجرامأحماض فلكية اكتشفت في 1999كربوكسيلية]]
[[تصنيف:كويكبات أبولوأميدات]]
[[تصنيف:كواكبفيتامينات صغيرة غير مرقمةب]]
[[تصنيف:أجرام كامنة المخاطركاربوكساميدات]]