افتح القائمة الرئيسية

تغييرات

تم إضافة 1٬861 بايت، ‏ قبل 3 سنوات
لا يوجد ملخص تحرير
{{Drugbox
[[ملف:Progesteron.svg|تصغير|البروجستيرون]]
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 444066687
| IUPAC_name = Pregn-4-ene-3,20-dione
| image = Progesteron.svg
| width = 230
| image2 = Progesterone-3D-balls.png
| alt2 = Progesterone molecule
<!--Clinical data-->
| tradename = Utrogestan, Prometrium, Endometrin, Crinone
| Drugs.com = {{drugs.com|monograph|progesterone}}
| MedlinePlus = a604017
| pregnancy_category = B ([[United States|USA]])
| routes_of_administration = Oral, transdermal, vaginal, rectal, intramuscular or subcutaneous injection, [[implant (medicine)|implant]]
<!--Pharmacokinetic data-->
| bioavailability = 10–15% (oral)<ref name="ArunNarendra2012" />
| protein_bound = 96%–99%
| metabolism = [[Hepatic]] ([[CYP2C19]], [[CYP3A4]], [[CYP2C9]])<ref name="pmid9328296" /><ref name="McKayWalters2013" />
| elimination_half-life = 16–18 hours (oral)<ref name="Zutshi2005" />
| excretion = [[Renal]]
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 57-83-0
| ATC_prefix = G03
| ATC_suffix = DA04
| PubChem = 5994
| IUPHAR_ligand = 2377
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00396
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5773
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4G7DS2Q64Y
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C00410
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17026
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 103
<!--Chemical data-->
| C=21 | H=30 | O=2
| molecular_weight = 314.46 g/mol
| smiles = CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RJKFOVLPORLFTN-LEKSSAKUSA-N
| synonyms = 4-pregnene-3,20-dione
| melting_point = 126
| specific_rotation = [α]<sub>D</sub>
}}
 
'''البروجستيرون''' أو ما يسمى بالإنجليزية (بالإنكليزية: Progesterone) هو هرمون أنثوي يفرزه الجسم الأصفر "Corpus luteum" في [[مبيض|المبيض]] خلال [[مرحلة بروجستيرونية|المرحلة البروجستيرونية]] اي في اخر اسبوعين من [[الدورة الشهرية]] للأنثى بعد ال[[إباضة|التبويض]]، وهو من الهرمونات الستيروئيدية.
 
يتم كذلك تكوين البروجستيرون عند الجنسين في [[قشر الكظر]]. كما يتم إفرازة بكميات كبيرة في [[مشيمة|المشيمة]] أثناء [[حمل|الحمل]]، وتتزايد كمياته بتقدم الحمل وتهبط قبل الولادة بأيام. هرمون البروجيسترون يعمل عن طريق تسميك [[بطانة الرحم]] المخاطية بحيث يمكن زرع البويضة المخصبة.