كورتيزون: الفرق بين النسختين
| [نسخة منشورة] | [نسخة منشورة] |
تم حذف المحتوى تمت إضافة المحتوى
Esra'a Majdy (نقاش | مساهمات) لا ملخص تعديل |
Esra'a Majdy (نقاش | مساهمات) لا ملخص تعديل |
||
سطر 1:
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 456660597
| ImageFile = Cortison.svg
| ImageSize = 200px
| ImageFile1 = Cortisone-3D-balls.png
| ImageSize1 = 200px
| IUPACName = (8''S'',9''S'',10''R'',13''S'',14''S'',17''R'')-17-Hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione
}}▼
| OtherNames =
|Section1={{Chembox Identifiers
| UNII_Ref = {{fdacite|changed|FDA}}
| IUPHAR_ligand = 5171
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 111861
| InChI = 1/C21H28O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-15,18,22,26H,3-8,10-11H2,1-2H3/t14-,15-,18+,19-,20-,21-/m0/s1
| InChIKey = MFYSYFVPBJMHGN-ZPOLXVRWBW
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H28O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-15,18,22,26H,3-8,10-11H2,1-2H3/t14-,15-,18+,19-,20-,21-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MFYSYFVPBJMHGN-ZPOLXVRWSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 193441
| CASNo = 53-06-5
| PubChem = 222786
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07749
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16962
| ATCCode_prefix = H02
| ATCCode_suffix = AB10
| ATC_Supplemental = {{ATC|S01|BA03}}
| SMILES = O=C(CO)[C@@]3(O)CC[C@H]2[C@@H]4CC\C1=C\C(=O)CC[C@]1(C)[C@H]4C(=O)C[C@@]23C
| MeSHName = Cortisone
}}
|Section2={{Chembox Properties
| C=21 | H=28 | O=5
| Appearance =
| Density =
| MeltingPtC =
| BoilingPt = 220:224
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
الكورتيزون هو هرمون 21 كربون ستيرويد. وهو واحد من الهرمونات الرئيسية الصادرة عن [[غدة كظرية | الغدة الكظرية]] في الاستجابة للإجهاد. يرتبط ال[[كورتيكوستيرويد]] ارتباطا وثيقا بال[[كورتيزول]] من جهة التركيب الكيميائي. فهو يستخدم لعلاج مجموعة متنوعة من الأمراض، ويمكن أن يستخدم ك[[علاج عن طريق الوريد]]، عن طريق الفم، في [[مفصل (أحياء) | المفصل]]، أو عبر الجلد. يثبط الكورتيزون نظام المناعة، وبالتالي يقلل الالتهاب والألم المصاحب والتورم في موقع الإصابة. يوجد مخاطر لاستخدام الكورتيزون، ولا سيما في الإستخدام على المدى الطويل. <ref name=mayo>{{cite web|url=http://www.mayoclinic.com/health/cortisone-shots/MY00268 |title=Cortisone shots |publisher=MayoClinic.com |date=2010-11-16 |accessdate=July 31, 2013}}</ref><ref name=mayorisk2>{{cite web|url=http://www.mayoclinic.com/health/steroids/HQ01431 |title=Prednisone and other corticosteroids: Balance the risks and benefits |publisher=MayoClinic.com |date=2010-06-05 |accessdate=2011-09-03}}</ref>
| |||